cas: 1094033-66-5 — see every product listed under this CAS number, including other names
4-(Piperazin-1-yl)benzoic acid hydrochloride, 97% (CAS 1094033-66-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F756539-250MG |
| cas | 1094033-66-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3501.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-piperazin-1-ylbenzoic acid;hydrochloride (CAS 1094033-66-5) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-piperazin-1-ylbenzoic acid;hydrochloride. InChIKey: SHGCPZZRYOCKIT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzoic acid;hydrochloride |
| InChIKey | SHGCPZZRYOCKIT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)