cas: 1094033-66-5 — see every product listed under this CAS number, including other names
4-(piperazin-1-yl)benzoic acid hydrochloride, 97%, 97% (CAS 1094033-66-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBGL-100mg |
| cas | 1094033-66-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-piperazin-1-ylbenzoic acid;hydrochloride (CAS 1094033-66-5) is a chemical compound with the molecular formula C11H15ClN2O2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-piperazin-1-ylbenzoic acid;hydrochloride. InChIKey: SHGCPZZRYOCKIT-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-piperazin-1-ylbenzoic acid;hydrochloride |
| InChIKey | SHGCPZZRYOCKIT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)