cas: 110475-33-7 — see every product listed under this CAS number, including other names
4-(Piperidin-1-yl)aniline hydrochloride, 98% (CAS 110475-33-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A813232-5g |
| cas | 110475-33-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8956.15 Pln | |
| AmBeed | 250mg | 1554.28 Pln | |
| AmBeed | 1g | 3032.05 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-piperidin-1-ylaniline;hydrochloride (CAS 110475-33-7) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-piperidin-1-ylaniline;hydrochloride. InChIKey: HYLYCYONEOJCCG-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 4-piperidin-1-ylaniline;hydrochloride |
| InChIKey | HYLYCYONEOJCCG-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)