cas: 6336-68-1 — see every product listed under this CAS number, including other names
4-(Piperidine-1-sulfonyl)-phenylamine, 98% (CAS 6336-68-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F015194-250MG |
| cas | 6336-68-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 622.72 Pln | |
| Fluorochem | 25g | 1039.24 Pln | |
| Fluorochem | 100g | 3798.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-piperidin-1-ylsulfonylaniline (CAS 6336-68-1) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: 4-piperidin-1-ylsulfonylaniline. InChIKey: ZTTBIWZAAMPNBE-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | 4-piperidin-1-ylsulfonylaniline |
| InChIKey | ZTTBIWZAAMPNBE-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)