cas: 30235-27-9 — see every product listed under this CAS number, including other names
4-(Pyridin-3-yl)thiazol-2-amine 97% (CAS 30235-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A327048-100mg |
| cas | 30235-27-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 615.13 Pln | |
| Ambeed | 25g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A327048 |
4-pyridin-3-yl-1,3-thiazol-2-amine (CAS 30235-27-9) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 4-pyridin-3-yl-1,3-thiazol-2-amine. InChIKey: XOHZQGAYUHOJPR-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 4-pyridin-3-yl-1,3-thiazol-2-amine |
| InChIKey | XOHZQGAYUHOJPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)