cas: 163260-77-3 — see every product listed under this CAS number, including other names
4-(Pyrrolidin-1-yl)aniline dihydrochloride, 97%, 97% (CAS 163260-77-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TXV-250mg |
| cas | 163260-77-3 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1067.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-pyrrolidin-1-ylaniline;dihydrochloride (CAS 163260-77-3) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 4-pyrrolidin-1-ylaniline;dihydrochloride. InChIKey: ISFTZBVGLLUPIF-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 4-pyrrolidin-1-ylaniline;dihydrochloride |
| InChIKey | ISFTZBVGLLUPIF-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)