CAS 140845-50-7 appears in our catalog under these names: (1,2,3,4-Tetrahydroisoquinolin-1-ylmethyl)amine dihydrochloride, 95%, (1,2,3,4-Tetrahydroisoquinolin-1-yl)methanamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,2,3,4-tetrahydroisoquinolin-1-ylmethanamine;dihydrochloride (CAS 140845-50-7) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinolin-1-ylmethanamine;dihydrochloride. InChIKey: IYQJSFFKBVSPBX-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinolin-1-ylmethanamine;dihydrochloride |
| InChIKey | IYQJSFFKBVSPBX-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=CC=CC=C21)CN.Cl.Cl |
Computed by PubChem (NCBI)