CAS 1052547-67-7 appears in our catalog under these names: N-(2-Amino-4-chlorophenyl)-n,n-diethylamine hydrochloride, 95%, 4-Chloro-N1,N1-diethylbenzene-1,2-diamine hydrochloride, 98%, 4-Chloro-1-N,1-N-diethylbenzene-1,2-diamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-chloro-1-N,1-N-diethylbenzene-1,2-diamine;hydrochloride (CAS 1052547-67-7) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 4-chloro-1-N,1-N-diethylbenzene-1,2-diamine;hydrochloride. InChIKey: OCYKEOJZYYRKPO-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 4-chloro-1-N,1-N-diethylbenzene-1,2-diamine;hydrochloride |
| InChIKey | OCYKEOJZYYRKPO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)