CAS 1003561-86-1 appears in our catalog under these names: 3-Pyrrolidin-2-ylmethylpyridine dihydrochloride, 95%, 3-(Pyrrolidin-2-ylmethyl)pyridine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-(pyrrolidin-2-ylmethyl)pyridine;dihydrochloride (CAS 1003561-86-1) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 3-(pyrrolidin-2-ylmethyl)pyridine;dihydrochloride. InChIKey: SNVVKNGYBOQTCB-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 3-(pyrrolidin-2-ylmethyl)pyridine;dihydrochloride |
| InChIKey | SNVVKNGYBOQTCB-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CC2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)