CAS 1181458-04-7 appears in our catalog under these names: 2-(2,3-Dihydro-1h-indol-1-yl)ethan-1-amine dihydrochloride, 95%, 1-(2-Aminoethyl)indoline Dihydrochloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
2-(2,3-dihydroindol-1-yl)ethanamine;dihydrochloride (CAS 1181458-04-7) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 2-(2,3-dihydroindol-1-yl)ethanamine;dihydrochloride. InChIKey: WMQJYMKHESNSME-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 2-(2,3-dihydroindol-1-yl)ethanamine;dihydrochloride |
| InChIKey | WMQJYMKHESNSME-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)CCN.Cl.Cl |
Computed by PubChem (NCBI)