cas: 880166-18-7 — see every product listed under this CAS number, including other names
4-(Thiophen-2-yl)tetrahydro-2H-pyran-4-carboxylic acid, 97% (CAS 880166-18-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788100-500MG |
| cas | 880166-18-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1726.49 Pln | |
| Fluorochem | 1g | 2720.93 Pln | |
| Fluorochem | 5g | 8000.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-thiophen-2-yloxane-4-carboxylic acid (CAS 880166-18-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: 4-thiophen-2-yloxane-4-carboxylic acid. InChIKey: VWYOZQWRYINSBP-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 4-thiophen-2-yloxane-4-carboxylic acid |
| InChIKey | VWYOZQWRYINSBP-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)