cas: 1261813-10-8 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)isoindolin-1-one 95% (CAS 1261813-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A584678-100mg |
| cas | 1261813-10-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 2956.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A584678 |
4-(trifluoromethyl)-2,3-dihydroisoindol-1-one (CAS 1261813-10-8) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 4-(trifluoromethyl)-2,3-dihydroisoindol-1-one. InChIKey: UYOAUXNGRMUPJJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 4-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | UYOAUXNGRMUPJJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)