cas: 1645-65-4 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)phenyl isothiocyanate (CAS 1645-65-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | CM78260K-5g |
| cas | 1645-65-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 515.77 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 25g | 549.82 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
1-isothiocyanato-4-(trifluoromethyl)benzene (CAS 1645-65-4) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 1-isothiocyanato-4-(trifluoromethyl)benzene. InChIKey: DQEVDFQAYLIBRD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-isothiocyanato-4-(trifluoromethyl)benzene |
| InChIKey | DQEVDFQAYLIBRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)