cas: 1645-65-4 — see every product listed under this CAS number, including other names
Benzene, 1-isothiocyanato-4-(trifluoromethyl)-, 98%, 98% (CAS 1645-65-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UXA-1g |
| cas | 1645-65-4 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 25g | 328.40 Pln | |
| Chemat | 100g | 1139.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-isothiocyanato-4-(trifluoromethyl)benzene (CAS 1645-65-4) is a chemical compound with the molecular formula C8H4F3NS and a molecular weight of 203.19 g/mol. IUPAC name: 1-isothiocyanato-4-(trifluoromethyl)benzene. InChIKey: DQEVDFQAYLIBRD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-isothiocyanato-4-(trifluoromethyl)benzene |
| InChIKey | DQEVDFQAYLIBRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N=C=S |
Computed by PubChem (NCBI)