cas: 99045-19-9 — see every product listed under this CAS number, including other names
4-(benzyloxy)-3,5-difluorophenol, 95%, 95% (CAS 99045-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK8O-100mg |
| cas | 99045-19-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 957.20 Pln | |
| Chemat | 250mg | 1403.60 Pln | |
| Chemat | 1g | 2747.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,5-difluoro-4-phenylmethoxyphenol (CAS 99045-19-9) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 3,5-difluoro-4-phenylmethoxyphenol. InChIKey: PCTUISSPYKBYNK-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O2 |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 3,5-difluoro-4-phenylmethoxyphenol |
| InChIKey | PCTUISSPYKBYNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)O)F |
Computed by PubChem (NCBI)