Products 1881289-01-5
CAS 1881289-01-5 is the registry number for 4-fluoro-3-[(3-fluorophenyl)(hydroxy)methyl]phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenol (CAS 1881289-01-5) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenol. InChIKey: IOYPEJWEABBJCA-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O2 |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 4-fluoro-3-[(3-fluorophenyl)-hydroxymethyl]phenol |
| InChIKey | IOYPEJWEABBJCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C2=C(C=CC(=C2)O)F)O |
Computed by PubChem (NCBI)