CAS 1881322-00-4 is the registry number for 2-(benzyloxy)-3,5-difluorophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3,5-difluoro-2-phenylmethoxyphenol (CAS 1881322-00-4) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 3,5-difluoro-2-phenylmethoxyphenol. InChIKey: GRWYIELKIZBZNC-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O2 |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 3,5-difluoro-2-phenylmethoxyphenol |
| InChIKey | GRWYIELKIZBZNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)F)O |
Computed by PubChem (NCBI)