Products 271254-90-1

CAS 271254-90-1 appears in our catalog under these names: 4-(benzyloxy)-2,3-difluorophenol, 98%, 2,3-Difluoro-4-(phenylmethoxy)phenol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

2,3-difluoro-4-phenylmethoxyphenol (CAS 271254-90-1) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 2,3-difluoro-4-phenylmethoxyphenol. InChIKey: LAHDIBOQQCUSEG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10F2O2
Molecular weight236.21 g/mol
IUPAC name2,3-difluoro-4-phenylmethoxyphenol
InChIKeyLAHDIBOQQCUSEG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C(=C(C=C2)O)F)F

Computed by PubChem (NCBI)