CAS 271254-90-1 appears in our catalog under these names: 4-(benzyloxy)-2,3-difluorophenol, 98%, 2,3-Difluoro-4-(phenylmethoxy)phenol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 1g.
2,3-difluoro-4-phenylmethoxyphenol (CAS 271254-90-1) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 2,3-difluoro-4-phenylmethoxyphenol. InChIKey: LAHDIBOQQCUSEG-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O2 |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 2,3-difluoro-4-phenylmethoxyphenol |
| InChIKey | LAHDIBOQQCUSEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)O)F)F |
Computed by PubChem (NCBI)