CAS 1881329-61-8 is the registry number for 5-(benzyloxy)-2,4-difluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,4-difluoro-5-phenylmethoxyphenol (CAS 1881329-61-8) is a chemical compound with the molecular formula C13H10F2O2 and a molecular weight of 236.21 g/mol. IUPAC name: 2,4-difluoro-5-phenylmethoxyphenol. InChIKey: VVRXWROSSBRIEZ-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O2 |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 2,4-difluoro-5-phenylmethoxyphenol |
| InChIKey | VVRXWROSSBRIEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C(=C2)O)F)F |
Computed by PubChem (NCBI)