4-(p-Tolyloxy)benzoic acid, 98%
cas: 21120-65-0 — see every product listed under this CAS number, including other names
4-(p-Tolyloxy)benzoic acid, 98% (CAS 21120-65-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A319113-250mg |
| cas | 21120-65-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2556.44 Pln | |
| BLDpharm | 250mg | 164.41 Pln | |
| BLDpharm | 1g | 247.72 Pln | |
| BLDpharm | 5g | 697.56 Pln | |
| BLDpharm | 25g | 2752.39 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 669.57 Pln | |
| Fluorochem | 10g | 1268.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(4-methylphenoxy)benzoic acid (CAS 21120-65-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 4-(4-methylphenoxy)benzoic acid. InChIKey: DCDYPMNXCDXNJZ-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-(4-methylphenoxy)benzoic acid |
| InChIKey | DCDYPMNXCDXNJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)