CAS 21218-94-0 appears in our catalog under these names: 4-Phenoxy-benzoic acid methyl ester, 98%, Methyl 4-phenoxybenzoate 98%, 4-Phenoxybenzoic acid methyl ester, 98%, 98%, 4-Phenoxybenzoic acid methyl ester, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg, 15g.
Methyl 4-phenoxybenzoate (CAS 21218-94-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: methyl 4-phenoxybenzoate. InChIKey: XMXLYEKPSHVLKD-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | methyl 4-phenoxybenzoate |
| InChIKey | XMXLYEKPSHVLKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)