Products 21120-65-0
CAS 21120-65-0 appears in our catalog under these names: 4-(4-Methylphenoxy)benzoic acid, 98%, 4–(4–Methylphenoxy)benzoic acid, 4-(4-Methylphenoxy)benzoic Acid, >96.0%(GC)(T), 4-(p-Tolyloxy)benzoic acid 98%, 4-(P-tolyloxy)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-(4-methylphenoxy)benzoic acid (CAS 21120-65-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 4-(4-methylphenoxy)benzoic acid. InChIKey: DCDYPMNXCDXNJZ-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-(4-methylphenoxy)benzoic acid |
| InChIKey | DCDYPMNXCDXNJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)