CAS 49843-53-0 is the registry number for methyl 3-hydroxy-5-phenylbenzoate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 3-hydroxy-5-phenylbenzoate (CAS 49843-53-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: methyl 3-hydroxy-5-phenylbenzoate. InChIKey: WVBJYTHKCQRAIE-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | methyl 3-hydroxy-5-phenylbenzoate |
| InChIKey | WVBJYTHKCQRAIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)