CAS 912280-35-4 appears in our catalog under these names: 4–hydroxynaphthalen–1–yl methacrylate, 4-Hydroxynaphthalen-1-yl methacrylate, 95%, 4-hydroxynaphthalen-1-yl methacrylate, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 50mg, 1g, 100mg.
(4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate (CAS 912280-35-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: (4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate. InChIKey: WZAHBKNHKAFCNM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | (4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate |
| InChIKey | WZAHBKNHKAFCNM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)