cas: 2263960-36-5 — see every product listed under this CAS number, including other names
4-(tert-Butoxy)-3-((tert-butoxycarbonyl)amino)-4-oxobutanoic acid 95% (CAS 2263960-36-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2628743-1g |
| cas | 2263960-36-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1382.75 Pln | |
| Ambeed | 10g | 2361.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2628743 |
4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 2263960-36-5) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: RAUQRYTYJIYLTF-UHFFFAOYSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | RAUQRYTYJIYLTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)