CAS 155542-33-9 appears in our catalog under these names: Boc-D-Asp(OtBu)-OH, 98%, (R)–4–(tert–Butoxy)–2–((tert–butoxycarbonyl)amino)–4–oxobutanoic acid, Boc-D-Asp(OtBu)-OH 97%, Boc-D-Asp(OtBu)-OH, 97%, 97%, Boc-D-aspartic acid-b-tert-butyl ester, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 500g, 250mg.
(2R)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 155542-33-9) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2R)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-MRVPVSSYSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2R)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)