CAS 2263960-36-5 appears in our catalog under these names: 2-tert-Butoxycarbonylamino-succinic acid 1-tert-butyl ester, 95%, 4-(tert-Butoxy)-3-((tert-butoxycarbonyl)amino)-4-oxobutanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 100mg, 50mg.
4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 2263960-36-5) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: RAUQRYTYJIYLTF-UHFFFAOYSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | RAUQRYTYJIYLTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)