Products 102673-95-0
CAS 102673-95-0 appears in our catalog under these names: 3-Methylglutarylcarnitine, 3-ME-GLUTARYL CARNITINE. Offered by: TRC, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 100mg, 5MG, 1 mg, 5 mg.
5-[1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-3-methyl-5-oxopentanoate (CAS 102673-95-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: 5-[1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-3-methyl-5-oxopentanoate. InChIKey: HFCPFJNSBPQJDP-UHFFFAOYSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | 5-[1-carboxy-3-(trimethylazaniumyl)propan-2-yl]oxy-3-methyl-5-oxopentanoate |
| InChIKey | HFCPFJNSBPQJDP-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)[O-])CC(=O)OC(CC(=O)O)C[N+](C)(C)C |
Computed by PubChem (NCBI)