CAS 1676-90-0 appears in our catalog under these names: N-tert-Butyloxycarbonyl-L-aspartic Acid b-tert-Butyl Ester, N-tert-Butyloxycarbonyl-L-aspartic Acid Beta-tert-Butyl Ester, Boc–Asp(OtBu)–OH, Boc-L-Asp(OtBu)-OH, N-Boc-L-aspartic acid 4-tert-butyl ester, 98% . Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 250g, 50g, 500g.
(2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 1676-90-0) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: PHJDCONJXLIIPW-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2S)-4-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | PHJDCONJXLIIPW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)