cas: 68284-01-5 — see every product listed under this CAS number, including other names
4-(tert-Butyl)benzimidamide hydrochloride 95% (CAS 68284-01-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A779218-250mg |
| cas | 68284-01-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A779218 |
4-tert-butylbenzenecarboximidamide;hydrochloride (CAS 68284-01-5) is a chemical compound with the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. IUPAC name: 4-tert-butylbenzenecarboximidamide;hydrochloride. InChIKey: ORSURHAFYGGLGI-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2 |
|---|---|
| Molecular weight | 212.72 g/mol |
| IUPAC name | 4-tert-butylbenzenecarboximidamide;hydrochloride |
| InChIKey | ORSURHAFYGGLGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=N)N.Cl |
Computed by PubChem (NCBI)