4-(tert-Butyl)benzylamine Hydrochloride, ≥95%, ≥95%
cas: 59528-30-2 — see every product listed under this CAS number, including other names
4-(tert-Butyl)benzylamine Hydrochloride, ≥95%, ≥95% (CAS 59528-30-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAKE-250mg |
| cas | 59528-30-2 |
| size | 250mg |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 10g | 395.60 Pln | |
| Chemat | 25g | 664.40 Pln | |
| Chemat | 100g | 1931.60 Pln |
properties
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(4-tert-butylphenyl)methanamine;hydrochloride (CAS 59528-30-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (4-tert-butylphenyl)methanamine;hydrochloride. InChIKey: MARHPSYFKRETIW-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (4-tert-butylphenyl)methanamine;hydrochloride |
| InChIKey | MARHPSYFKRETIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
(4-tert-butylphenyl)methanamine hydrochloride, 4-(tert-Butyl)benzylamine Hydrochloride, (4-tert-butylphenyl)methanamine;hydrochloride, Benzenemethanamine, 4-(1,1-dimethylethyl)-, hydrochloride, 4-(tert-Butyl)benzylamine HCl, 4-tert-Butylbenzylamine hydrochloride, 4-(tert-Butyl)benzylamineHydrochloride, 4-(t-Butyl)benzylamine hydrochloride, 1-(4-tert-Butylphenyl)methanamine--hydrogen chloride (1/1)