CAS 69187-60-6 appears in our catalog under these names: 2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, 2,2-Dimethyl-1-phenylpropan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride (CAS 69187-60-6) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: BMOFDSTXFQCVDC-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 2,2-dimethyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | BMOFDSTXFQCVDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)