Products 1803586-64-2
CAS 1803586-64-2 appears in our catalog under these names: 1-(2,4,6-Trimethylphenyl)ethan-1-amine hydrochloride, 95%, 1–Mesitylethanamine hydrochloride, 1-Mesitylethanamine hydrochloride, 97%, 97%, 1-Mesitylethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride (CAS 1803586-64-2) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride. InChIKey: VFBGENMGPYITQS-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)ethanamine;hydrochloride |
| InChIKey | VFBGENMGPYITQS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(C)N)C.Cl |
Computed by PubChem (NCBI)