CAS 1049755-55-6 appears in our catalog under these names: 4–((2,4–Dimethylphenyl)sulfanyl)aniline hydrochloride, 4-[(2,4-Dimethylphenyl)sulfanyl]aniline hydrochloride, 95%, 95%, 4-[(2,4-Dimethylphenyl)sulfanyl]aniline hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride (CAS 1049755-55-6) is a chemical compound with the molecular formula C14H16ClNS and a molecular weight of 265.8 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride. InChIKey: DLQYXWSCPPGOJA-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNS |
|---|---|
| Molecular weight | 265.8 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)sulfanylaniline;hydrochloride |
| InChIKey | DLQYXWSCPPGOJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SC2=CC=C(C=C2)N)C.Cl |
Computed by PubChem (NCBI)