cas: 102362-04-9 — see every product listed under this CAS number, including other names
4-Acetyl-2-methoxybenzoic acid 95% (CAS 102362-04-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187368-1g |
| cas | 102362-04-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1182.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A187368 |
4-acetyl-2-methoxybenzoic acid (CAS 102362-04-9) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-acetyl-2-methoxybenzoic acid. InChIKey: OFDZQWIOLLRCOX-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-acetyl-2-methoxybenzoic acid |
| InChIKey | OFDZQWIOLLRCOX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)OC |
Computed by PubChem (NCBI)