4-Acetylbenzoic acid 97%
cas: 586-89-0 — see every product listed under this CAS number, including other names
4-Acetylbenzoic acid 97% (CAS 586-89-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205870-10g |
| cas | 586-89-0 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2300.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205870 |
4-acetylbenzoic acid (CAS 586-89-0) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-acetylbenzoic acid. InChIKey: QBHDSQZASIBAAI-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-acetylbenzoic acid |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)