cas: 16803-92-2 — see every product listed under this CAS number, including other names
4-Amino- N -(4-chloro-phenyl)-benzenesulfonamide, 95% (CAS 16803-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F030472-100MG |
| cas | 16803-92-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 1122.54 Pln | |
| Fluorochem | 5g | 3184.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-N-(4-chlorophenyl)benzenesulfonamide (CAS 16803-92-2) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 4-amino-N-(4-chlorophenyl)benzenesulfonamide. InChIKey: RBJGYDGKXTYSSL-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 4-amino-N-(4-chlorophenyl)benzenesulfonamide |
| InChIKey | RBJGYDGKXTYSSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)