CAS 438017-93-7 is the registry number for N-(3-Chlorophenyl) 3-aminobenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
3-amino-N-(3-chlorophenyl)benzenesulfonamide (CAS 438017-93-7) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 3-amino-N-(3-chlorophenyl)benzenesulfonamide. InChIKey: FDVYFKMOPNABOK-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 3-amino-N-(3-chlorophenyl)benzenesulfonamide |
| InChIKey | FDVYFKMOPNABOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC(=CC=C2)Cl)N |
Computed by PubChem (NCBI)