CAS 927993-04-2 appears in our catalog under these names: 2-((2-Chlorobenzyl)amino)-4-methylthiazole-5-carboxylic acid, 97%, 2-[(2-Chlorobenzyl)amino]-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-[(2-chlorophenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 927993-04-2) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 2-[(2-chlorophenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: KDJVVPBKOHEDDG-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methylamino]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | KDJVVPBKOHEDDG-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NCC2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)