Products 1156236-32-6
CAS 1156236-32-6 is the registry number for 2-Chloro-n-methyl-n-phenylpyridine-3-sulfonamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-N-methyl-N-phenylpyridine-3-sulfonamide (CAS 1156236-32-6) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 2-chloro-N-methyl-N-phenylpyridine-3-sulfonamide. InChIKey: WGHGFEJUVMBBOI-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 2-chloro-N-methyl-N-phenylpyridine-3-sulfonamide |
| InChIKey | WGHGFEJUVMBBOI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)S(=O)(=O)C2=C(N=CC=C2)Cl |
Computed by PubChem (NCBI)