CAS 327092-56-8 appears in our catalog under these names: 3-Amino-n-(4-chloro-phenyl)-benzenesulfonamide, 95%, 3-Amino-N-(4-chlorophenyl)benzene-1-sulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-amino-N-(4-chlorophenyl)benzenesulfonamide (CAS 327092-56-8) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 3-amino-N-(4-chlorophenyl)benzenesulfonamide. InChIKey: XNIDHJLSQXPDOP-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 3-amino-N-(4-chlorophenyl)benzenesulfonamide |
| InChIKey | XNIDHJLSQXPDOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)