cas: 99011-02-6 — see every product listed under this CAS number, including other names
4-Amino-1-isobutyl-1H-imidazo[4,5-c]quinoline (CAS 99011-02-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386709-100MG |
| cas | 99011-02-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1346.42 Pln |
| delivery time | 2-3 weeks |
|---|
Imiquimod is an imidazoquinoline fused [4,5-c] carrying isobutyl and amino substituents at N-1 and C-4 respectively. A prescription medication, it acts as an immune response modifier and is used to treat genital warts, superficial basal cell carcinoma, and actinic keratosis. It has a role as an antineoplastic agent and an interferon inducer.
Source: ChEBI
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine |
| InChIKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)