cas: 99011-02-6 — see every product listed under this CAS number, including other names
Imiquimod 98% (CAS 99011-02-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A161049-1g |
| cas | 99011-02-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1405.00 Pln | |
| Ambeed | 100g | 4469.94 Pln | |
| Ambeed | 500g | 17669.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A161049 |
Imiquimod is an imidazoquinoline fused [4,5-c] carrying isobutyl and amino substituents at N-1 and C-4 respectively. A prescription medication, it acts as an immune response modifier and is used to treat genital warts, superficial basal cell carcinoma, and actinic keratosis. It has a role as an antineoplastic agent and an interferon inducer.
Source: ChEBI
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine |
| InChIKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)