CAS 122033-75-4 appears in our catalog under these names: 4-AMINO-2,3,5-TRIFLUOROBENZOIC ACID, 98%, 4-Amino-2,3,5-trifluorobenzoic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-amino-2,3,5-trifluorobenzoic acid (CAS 122033-75-4) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 4-amino-2,3,5-trifluorobenzoic acid. InChIKey: RLVOSLQIZYMCCT-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 4-amino-2,3,5-trifluorobenzoic acid |
| InChIKey | RLVOSLQIZYMCCT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)N)F)F)C(=O)O |
Computed by PubChem (NCBI)