cas: 778-97-2 — see every product listed under this CAS number, including other names
4-Amino-2-(ethylthio)-5-pyrimidinecarboxylic acid ethyl ester, 97%, 97% (CAS 778-97-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1167W5-250mg |
| cas | 778-97-2 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 100mg | 414.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate (CAS 778-97-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate. InChIKey: ODFLPYCOQXPONS-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate |
| InChIKey | ODFLPYCOQXPONS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1N)SCC |
Computed by PubChem (NCBI)