cas: 778-97-2 — see every product listed under this CAS number, including other names
ETHYL 4-AMINO-2-ETHYLSULFANYL-PYRIMIDINE-5-CARBOXYLATE, 97% (CAS 778-97-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303041-100MG |
| cas | 778-97-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1034.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate (CAS 778-97-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate. InChIKey: ODFLPYCOQXPONS-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | ethyl 4-amino-2-ethylsulfanylpyrimidine-5-carboxylate |
| InChIKey | ODFLPYCOQXPONS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1N)SCC |
Computed by PubChem (NCBI)