cas: 866329-57-9 — see every product listed under this CAS number, including other names
4-Amino-3-Methoxy-N-Methylbenzamide, 97%, 97% (CAS 866329-57-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115OKG-100mg |
| cas | 866329-57-9 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 10g | 827.60 Pln | |
| Chemat | 15g | 1173.20 Pln | |
| Chemat | 25g | 1720.40 Pln | |
| Chemat | 50g | 3208.40 Pln | |
| Chemat | 100g | 6338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-3-methoxy-N-methylbenzamide (CAS 866329-57-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 4-amino-3-methoxy-N-methylbenzamide. InChIKey: WPMXJQCASHLEMI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-amino-3-methoxy-N-methylbenzamide |
| InChIKey | WPMXJQCASHLEMI-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)N)OC |
Computed by PubChem (NCBI)