4-Amino-3-methoxy-N-methylbenzamide, 97%
cas: 866329-57-9 — see every product listed under this CAS number, including other names
4-Amino-3-methoxy-N-methylbenzamide, 97% (CAS 866329-57-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 25g, 50g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F737848-1G |
| cas | 866329-57-9 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 914.28 Pln | |
| Fluorochem | 10g | 1742.11 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 837.62 Pln | |
| Ambeed | 10g | 1499.56 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 25g | 1394.00 Pln | |
| Chemat | 50g | 2714.00 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4-amino-3-methoxy-N-methylbenzamide (CAS 866329-57-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 4-amino-3-methoxy-N-methylbenzamide. InChIKey: WPMXJQCASHLEMI-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-amino-3-methoxy-N-methylbenzamide |
| InChIKey | WPMXJQCASHLEMI-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)N)OC |
Computed by PubChem (NCBI)