cas: 1095188-12-7 — see every product listed under this CAS number, including other names
4-Amino-3-fluoro-2-(trifluoromethyl)benzonitrile, 98% (CAS 1095188-12-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: AmBeed, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A289156-100mg |
| cas | 1095188-12-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 3455.20 Pln | |
| AmBeed | 250mg | 5994.10 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2474.00 Pln | |
| Chemat | 25g | 4610.00 Pln | |
| Chemat | 50g | 6266.00 Pln | |
| Chemat | 100g | 6328.40 Pln | |
| Chemat | 250g | 12606.80 Pln | |
| Chemat | 500g | 20428.80 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile (CAS 1095188-12-7) is a chemical compound with the molecular formula C8H4F4N2 and a molecular weight of 204.12 g/mol. IUPAC name: 4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile. InChIKey: OWIGNTFYLJUGDK-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2 |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | 4-amino-3-fluoro-2-(trifluoromethyl)benzonitrile |
| InChIKey | OWIGNTFYLJUGDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C#N)C(F)(F)F)F)N |
Computed by PubChem (NCBI)