CAS 18645-92-6 appears in our catalog under these names: 7-Fluoro-2-(trifluoromethyl)-1H-benzo(d)imidazole, 95+%, 4-Fluoro-2-(trifluoromethyl)-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-fluoro-2-(trifluoromethyl)-1H-benzimidazole (CAS 18645-92-6) is a chemical compound with the molecular formula C8H4F4N2 and a molecular weight of 204.12 g/mol. IUPAC name: 4-fluoro-2-(trifluoromethyl)-1H-benzimidazole. InChIKey: KJUWDDLXAIAGAQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4N2 |
|---|---|
| Molecular weight | 204.12 g/mol |
| IUPAC name | 4-fluoro-2-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | KJUWDDLXAIAGAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)